C33H31Cl2FN4O4Si — CID 174040174
CID 174040174 (PubChem CID 174040174) has the molecular formula C33H31Cl2FN4O4Si and a molecular weight of 665.63 g/mol.
| Compound Name | CID 174040174 |
|---|---|
| PubChem CID | 174040174 |
| Molecular Formula | C33H31Cl2FN4O4Si |
| Molecular Weight | 665.63 g/mol |
| Exact Mass | 664.15 |
| IUPAC Name | — |
| SMILES | C[Si]C(C1CCO1)n1c(CN2CCC(c3cccc4c3OC(c3ccc(Cl)cc3F)C=C4Cl)CC2)nc2ccc(C(=O)O)nc21 |
| InChI | InChI=1S/C33H31Cl2FN4O4Si/c1-45-32(27-11-14-43-27)40-29(37-25-7-8-26(33(41)42)38-31(25)40)17-39-12-9-18(10-13-39)20-3-2-4-21-23(35)16-28(44-30(20)21)22-6-5-19(34)15-24(22)36/h2-8,15-16,18,27-28,32H,9-14,17H2,1H3,(H,41,42) |
| InChIKey | KVUSQFFNRZZFLL-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.63 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|