C34H30Cl2FN3O4Si — CID 174040139
CID 174040139 (PubChem CID 174040139) has the molecular formula C34H30Cl2FN3O4Si and a molecular weight of 662.62 g/mol.
| Compound Name | CID 174040139 |
|---|---|
| PubChem CID | 174040139 |
| Molecular Formula | C34H30Cl2FN3O4Si |
| Molecular Weight | 662.62 g/mol |
| Exact Mass | 661.14 |
| IUPAC Name | — |
| SMILES | O=C(O)c1ccc2nc(CN3CCC(c4cccc5c4O[C@H](c4ccc(Cl)cc4Cl)C=C5F)CC3)n([C@@H]3[Si][C@H]3C3CCO3)c2c1 |
| InChI | InChI=1S/C34H30Cl2FN3O4Si/c35-20-5-6-22(24(36)15-20)29-16-25(37)23-3-1-2-21(31(23)44-29)18-8-11-39(12-9-18)17-30-38-26-7-4-19(34(41)42)14-27(26)40(30)33-32(45-33)28-10-13-43-28/h1-7,14-16,18,28-29,32-33H,8-13,17H2,(H,41,42)/t28?,29-,32-,33+/m0/s1 |
| InChIKey | QTCUDQSQAIENIX-SWNPVNDUSA-N |
| XLogP | 7.66 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.62 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|