C34H31ClF2N4O4Si — CID 174040057
CID 174040057 (PubChem CID 174040057) has the molecular formula C34H31ClF2N4O4Si and a molecular weight of 661.18 g/mol.
| Compound Name | CID 174040057 |
|---|---|
| PubChem CID | 174040057 |
| Molecular Formula | C34H31ClF2N4O4Si |
| Molecular Weight | 661.18 g/mol |
| Exact Mass | 660.18 |
| IUPAC Name | — |
| SMILES | O=C(O)c1ccc2nc(CN3CCN(c4cccc5c4OC(c4ccc(Cl)cc4F)C=C5F)CC3)n([C@@H]3[Si]CC3C3CCO3)c2c1 |
| InChI | InChI=1S/C34H31ClF2N4O4Si/c35-20-5-6-21(24(36)15-20)30-16-25(37)22-2-1-3-27(32(22)45-30)40-11-9-39(10-12-40)17-31-38-26-7-4-19(34(42)43)14-28(26)41(31)33-23(18-46-33)29-8-13-44-29/h1-7,14-16,23,29-30,33H,8-13,17-18H2,(H,42,43)/t23?,29?,30?,33-/m1/s1 |
| InChIKey | OSQZLJLTKHVTKV-ZEBRNWAGSA-N |
| XLogP | 6.33 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.18 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|