C28H28FN3O4Si — CID 174040136
CID 174040136 (PubChem CID 174040136) has the molecular formula C28H28FN3O4Si and a molecular weight of 517.63 g/mol.
| Compound Name | CID 174040136 |
|---|---|
| PubChem CID | 174040136 |
| Molecular Formula | C28H28FN3O4Si |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.18 |
| IUPAC Name | — |
| SMILES | O=C(O)c1ccc2nc(CN3CCC(c4cccc5c4OCC=C5F)CC3)n(C3[Si]C3[C@@H]3CCO3)c2c1 |
| InChI | InChI=1S/C28H28FN3O4Si/c29-20-8-12-36-25-18(2-1-3-19(20)25)16-6-10-31(11-7-16)15-24-30-21-5-4-17(28(33)34)14-22(21)32(24)27-26(37-27)23-9-13-35-23/h1-5,8,14,16,23,26-27H,6-7,9-13,15H2,(H,33,34)/t23-,26?,27?/m0/s1 |
| InChIKey | FYKOKGHGZKDWNQ-IVINKASTSA-N |
| XLogP | 4.61 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|