C23H39FN2O4SSi — CID 174041563
tert-butyl N-[1-[4-[[tert-butyl(dimethyl)silyl]sulfamoyl]-3-fluorophenyl]ethyl]-N-cyclobutylcarbamate (PubChem CID 174041563) has the molecular formula C23H39FN2O4SSi and a molecular weight of 486.73 g/mol. Its IUPAC name is tert-butyl N-[1-[4-[[tert-butyl(dimethyl)silyl]sulfamoyl]-3-fluorophenyl]ethyl]-N-cyclobutylcarbamate.
| Compound Name | tert-butyl N-[1-[4-[[tert-butyl(dimethyl)silyl]sulfamoyl]-3-fluorophenyl]ethyl]-N-cyclobutylcarbamate |
|---|---|
| PubChem CID | 174041563 |
| Molecular Formula | C23H39FN2O4SSi |
| Molecular Weight | 486.73 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | tert-butyl N-[1-[4-[[tert-butyl(dimethyl)silyl]sulfamoyl]-3-fluorophenyl]ethyl]-N-cyclobutylcarbamate |
| SMILES | CC(c1ccc(S(=O)(=O)N[Si](C)(C)C(C)(C)C)c(F)c1)N(C(=O)OC(C)(C)C)C1CCC1 |
| InChI | InChI=1S/C23H39FN2O4SSi/c1-16(26(18-11-10-12-18)21(27)30-22(2,3)4)17-13-14-20(19(24)15-17)31(28,29)25-32(8,9)23(5,6)7/h13-16,18,25H,10-12H2,1-9H3 |
| InChIKey | KWDUCAKKMOQGOW-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.73 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|