C13H15N5O3 — CID 17404193
propan-2-yl 4-[[2-(tetrazol-1-yl)acetyl]amino]benzoate (PubChem CID 17404193) has the molecular formula C13H15N5O3 and a molecular weight of 289.30 g/mol. Its IUPAC name is propan-2-yl 4-[[2-(tetrazol-1-yl)acetyl]amino]benzoate.
| Compound Name | propan-2-yl 4-[[2-(tetrazol-1-yl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 17404193 |
| Molecular Formula | C13H15N5O3 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | propan-2-yl 4-[[2-(tetrazol-1-yl)acetyl]amino]benzoate |
| SMILES | CC(C)OC(=O)c1ccc(NC(=O)Cn2cnnn2)cc1 |
| InChI | InChI=1S/C13H15N5O3/c1-9(2)21-13(20)10-3-5-11(6-4-10)15-12(19)7-18-8-14-16-17-18/h3-6,8-9H,7H2,1-2H3,(H,15,19) |
| InChIKey | REBDGYRBPGBATI-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |