C31H37BN4O5S — CID 174043904
CID 174043904 (PubChem CID 174043904) has the molecular formula C31H37BN4O5S and a molecular weight of 588.54 g/mol.
| Compound Name | CID 174043904 |
|---|---|
| PubChem CID | 174043904 |
| Molecular Formula | C31H37BN4O5S |
| Molecular Weight | 588.54 g/mol |
| Exact Mass | 588.26 |
| IUPAC Name | — |
| SMILES | [B]c1c(NS(=O)(=O)c2ccccc2-c2ccc(CN3C(=O)C4(CCCC4)N=C3CCCC)cc2COCC)noc1C |
| InChI | InChI=1S/C31H37BN4O5S/c1-4-6-13-27-33-31(16-9-10-17-31)30(37)36(27)19-22-14-15-24(23(18-22)20-40-5-2)25-11-7-8-12-26(25)42(38,39)35-29-28(32)21(3)41-34-29/h7-8,11-12,14-15,18H,4-6,9-10,13,16-17,19-20H2,1-3H3,(H,34,35) |
| InChIKey | ZTAKITYLVADLKQ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 114.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.54 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|