C28H35N3O5S — CID 174348205
N-[2-[4-[(2-butyl-4-oxo-1,3-diazaspiro[4.4]non-1-en-3-yl)methyl]-2-(ethoxymethyl)phenyl]phenyl]sulfonylformamide (PubChem CID 174348205) has the molecular formula C28H35N3O5S and a molecular weight of 525.67 g/mol. Its IUPAC name is N-[2-[4-[(2-butyl-4-oxo-1,3-diazaspiro[4.4]non-1-en-3-yl)methyl]-2-(ethoxymethyl)phenyl]phenyl]sulfonylformamide.
| Compound Name | N-[2-[4-[(2-butyl-4-oxo-1,3-diazaspiro[4.4]non-1-en-3-yl)methyl]-2-(ethoxymethyl)phenyl]phenyl]sulfonylformamide |
|---|---|
| PubChem CID | 174348205 |
| Molecular Formula | C28H35N3O5S |
| Molecular Weight | 525.67 g/mol |
| Exact Mass | 525.23 |
| IUPAC Name | N-[2-[4-[(2-butyl-4-oxo-1,3-diazaspiro[4.4]non-1-en-3-yl)methyl]-2-(ethoxymethyl)phenyl]phenyl]sulfonylformamide |
| SMILES | CCCCC1=NC2(CCCC2)C(=O)N1Cc1ccc(-c2ccccc2S(=O)(=O)NC=O)c(COCC)c1 |
| InChI | InChI=1S/C28H35N3O5S/c1-3-5-12-26-30-28(15-8-9-16-28)27(33)31(26)18-21-13-14-23(22(17-21)19-36-4-2)24-10-6-7-11-25(24)37(34,35)29-20-32/h6-7,10-11,13-14,17,20H,3-5,8-9,12,15-16,18-19H2,1-2H3,(H,29,32) |
| InChIKey | OLMJCZZCTZVDAS-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.67 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|