C31H35F3N4O4S — CID 22574689
2-[4-[(2-butyl-4-oxo-1,3-diazaspiro[4.4]non-1-en-3-yl)methyl]-2-(2,2,2-trifluoroethyl)phenyl]-N-(3,4-dimethyl-1,2-oxazol-5-yl)benzenesulfonamide (PubChem CID 22574689) has the molecular formula C31H35F3N4O4S and a molecular weight of 616.71 g/mol. Its IUPAC name is 2-[4-[(2-butyl-4-oxo-1,3-diazaspiro[4.4]non-1-en-3-yl)methyl]-2-(2,2,2-trifluoroethyl)phenyl]-N-(3,4-dimethyl-1,2-oxazol-5-yl)benzenesulfonamide.
| Compound Name | 2-[4-[(2-butyl-4-oxo-1,3-diazaspiro[4.4]non-1-en-3-yl)methyl]-2-(2,2,2-trifluoroethyl)phenyl]-N-(3,4-dimethyl-1,2-oxazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 22574689 |
| Molecular Formula | C31H35F3N4O4S |
| Molecular Weight | 616.71 g/mol |
| Exact Mass | 616.23 |
| IUPAC Name | 2-[4-[(2-butyl-4-oxo-1,3-diazaspiro[4.4]non-1-en-3-yl)methyl]-2-(2,2,2-trifluoroethyl)phenyl]-N-(3,4-dimethyl-1,2-oxazol-5-yl)benzenesulfonamide |
| SMILES | CCCCC1=NC2(CCCC2)C(=O)N1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)c(CC(F)(F)F)c1 |
| InChI | InChI=1S/C31H35F3N4O4S/c1-4-5-12-27-35-30(15-8-9-16-30)29(39)38(27)19-22-13-14-24(23(17-22)18-31(32,33)34)25-10-6-7-11-26(25)43(40,41)37-28-20(2)21(3)36-42-28/h6-7,10-11,13-14,17,37H,4-5,8-9,12,15-16,18-19H2,1-3H3 |
| InChIKey | ZDEYBWNIRWWVOQ-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 104.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.71 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |