C30H29BFN9O3S — CID 174045739
CID 174045739 (PubChem CID 174045739) has the molecular formula C30H29BFN9O3S and a molecular weight of 625.50 g/mol.
| Compound Name | CID 174045739 |
|---|---|
| PubChem CID | 174045739 |
| Molecular Formula | C30H29BFN9O3S |
| Molecular Weight | 625.50 g/mol |
| Exact Mass | 625.22 |
| IUPAC Name | — |
| SMILES | [B]C(C)(F)C1(c2cccc3c2nc(N[C@@H]2CN(C(=O)OCc4ccccc4)CCNC2=O)n2nc(-c4cnn(S)c4)nc32)CC1 |
| InChI | InChI=1S/C30H29BFN9O3S/c1-29(31,32)30(10-11-30)21-9-5-8-20-23(21)36-27(41-25(20)37-24(38-41)19-14-34-40(45)15-19)35-22-16-39(13-12-33-26(22)42)28(43)44-17-18-6-3-2-4-7-18/h2-9,14-15,22,45H,10-13,16-17H2,1H3,(H,33,42)(H,35,36)/t22-,29?/m1/s1 |
| InChIKey | XYJYVLTYDOEUAU-DMDVIOLWSA-N |
| XLogP | 3.27 |
| TPSA | 131.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.50 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|