C14H19ClN2O4 — CID 45072569
1-O-benzyl 3-O-methyl (3R)-piperazine-1,3-dicarboxylate;hydrochloride (PubChem CID 45072569) has the molecular formula C14H19ClN2O4 and a molecular weight of 314.77 g/mol. Its IUPAC name is 1-O-benzyl 3-O-methyl (3R)-piperazine-1,3-dicarboxylate;hydrochloride.
| Compound Name | 1-O-benzyl 3-O-methyl (3R)-piperazine-1,3-dicarboxylate;hydrochloride |
|---|---|
| PubChem CID | 45072569 |
| Molecular Formula | C14H19ClN2O4 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 1-O-benzyl 3-O-methyl (3R)-piperazine-1,3-dicarboxylate;hydrochloride |
| SMILES | COC(=O)[C@H]1CN(C(=O)OCc2ccccc2)CCN1.Cl |
| InChI | InChI=1S/C14H18N2O4.ClH/c1-19-13(17)12-9-16(8-7-15-12)14(18)20-10-11-5-3-2-4-6-11;/h2-6,12,15H,7-10H2,1H3;1H/t12-;/m1./s1 |
| InChIKey | KBTDRWBNFLCGPG-UTONKHPSSA-N |
| XLogP | 1.19 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |