C29H35N3O4 — CID 177261956
benzyl 3-[[bis[(4-methoxyphenyl)methyl]amino]methyl]piperazine-1-carboxylate (PubChem CID 177261956) has the molecular formula C29H35N3O4 and a molecular weight of 489.62 g/mol. Its IUPAC name is benzyl 3-[[bis[(4-methoxyphenyl)methyl]amino]methyl]piperazine-1-carboxylate.
| Compound Name | benzyl 3-[[bis[(4-methoxyphenyl)methyl]amino]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 177261956 |
| Molecular Formula | C29H35N3O4 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.26 |
| IUPAC Name | benzyl 3-[[bis[(4-methoxyphenyl)methyl]amino]methyl]piperazine-1-carboxylate |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)CC2CN(C(=O)OCc3ccccc3)CCN2)cc1 |
| InChI | InChI=1S/C29H35N3O4/c1-34-27-12-8-23(9-13-27)18-31(19-24-10-14-28(35-2)15-11-24)20-26-21-32(17-16-30-26)29(33)36-22-25-6-4-3-5-7-25/h3-15,26,30H,16-22H2,1-2H3 |
| InChIKey | XMSKBLSIEVLNCS-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |