C21H25FN2O4 — CID 91254169
benzyl (3R)-3-[2-(5-fluoro-2-methoxyphenoxy)ethyl]piperazine-1-carboxylate (PubChem CID 91254169) has the molecular formula C21H25FN2O4 and a molecular weight of 388.44 g/mol. Its IUPAC name is benzyl (3R)-3-[2-(5-fluoro-2-methoxyphenoxy)ethyl]piperazine-1-carboxylate.
| Compound Name | benzyl (3R)-3-[2-(5-fluoro-2-methoxyphenoxy)ethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 91254169 |
| Molecular Formula | C21H25FN2O4 |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | benzyl (3R)-3-[2-(5-fluoro-2-methoxyphenoxy)ethyl]piperazine-1-carboxylate |
| SMILES | COc1ccc(F)cc1OCC[C@@H]1CN(C(=O)OCc2ccccc2)CCN1 |
| InChI | InChI=1S/C21H25FN2O4/c1-26-19-8-7-17(22)13-20(19)27-12-9-18-14-24(11-10-23-18)21(25)28-15-16-5-3-2-4-6-16/h2-8,13,18,23H,9-12,14-15H2,1H3/t18-/m1/s1 |
| InChIKey | BUHYOMMXPOBORS-GOSISDBHSA-N |
| XLogP | 3.21 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |