C21H25N3O5 — CID 91394380
benzyl (3R)-3-[2-[(6-methoxycarbonyl-3-pyridinyl)oxy]ethyl]piperazine-1-carboxylate (PubChem CID 91394380) has the molecular formula C21H25N3O5 and a molecular weight of 399.45 g/mol. Its IUPAC name is benzyl (3R)-3-[2-[(6-methoxycarbonyl-3-pyridinyl)oxy]ethyl]piperazine-1-carboxylate.
| Compound Name | benzyl (3R)-3-[2-[(6-methoxycarbonyl-3-pyridinyl)oxy]ethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 91394380 |
| Molecular Formula | C21H25N3O5 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | benzyl (3R)-3-[2-[(6-methoxycarbonyl-3-pyridinyl)oxy]ethyl]piperazine-1-carboxylate |
| SMILES | COC(=O)c1ccc(OCC[C@@H]2CN(C(=O)OCc3ccccc3)CCN2)cn1 |
| InChI | InChI=1S/C21H25N3O5/c1-27-20(25)19-8-7-18(13-23-19)28-12-9-17-14-24(11-10-22-17)21(26)29-15-16-5-3-2-4-6-16/h2-8,13,17,22H,9-12,14-15H2,1H3/t17-/m1/s1 |
| InChIKey | ZEKSERACSIPYMY-QGZVFWFLSA-N |
| XLogP | 2.25 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |