C15H22N2O5 — CID 68985329
(3R)-3-[2-(2,3-dimethoxyphenoxy)ethyl]piperazine-1-carboxylic acid (PubChem CID 68985329) has the molecular formula C15H22N2O5 and a molecular weight of 310.35 g/mol. Its IUPAC name is (3R)-3-[2-(2,3-dimethoxyphenoxy)ethyl]piperazine-1-carboxylic acid.
| Compound Name | (3R)-3-[2-(2,3-dimethoxyphenoxy)ethyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 68985329 |
| Molecular Formula | C15H22N2O5 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | (3R)-3-[2-(2,3-dimethoxyphenoxy)ethyl]piperazine-1-carboxylic acid |
| SMILES | COc1cccc(OCC[C@@H]2CN(C(=O)O)CCN2)c1OC |
| InChI | InChI=1S/C15H22N2O5/c1-20-12-4-3-5-13(14(12)21-2)22-9-6-11-10-17(15(18)19)8-7-16-11/h3-5,11,16H,6-10H2,1-2H3,(H,18,19)/t11-/m1/s1 |
| InChIKey | FPHWVJFXXHPLTH-LLVKDONJSA-N |
| XLogP | 1.42 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |