C13H21ClN2O3 — CID 174567901
benzene;chloromethane;(3S)-3-(hydroxymethyl)piperazine-1-carboxylic acid (PubChem CID 174567901) has the molecular formula C13H21ClN2O3 and a molecular weight of 288.77 g/mol. Its IUPAC name is benzene;chloromethane;(3S)-3-(hydroxymethyl)piperazine-1-carboxylic acid.
| Compound Name | benzene;chloromethane;(3S)-3-(hydroxymethyl)piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 174567901 |
| Molecular Formula | C13H21ClN2O3 |
| Molecular Weight | 288.77 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | benzene;chloromethane;(3S)-3-(hydroxymethyl)piperazine-1-carboxylic acid |
| SMILES | CCl.O=C(O)N1CCN[C@H](CO)C1.c1ccccc1 |
| InChI | InChI=1S/C6H12N2O3.C6H6.CH3Cl/c9-4-5-3-8(6(10)11)2-1-7-5;1-2-4-6-5-3-1;1-2/h5,7,9H,1-4H2,(H,10,11);1-6H;1H3/t5-;;/m0../s1 |
| InChIKey | JNZFUQOIVGGCQW-XRIGFGBMSA-N |
| XLogP | 1.47 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.77 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|