C6H10N2O4 — CID 68637111
(3S)-piperazine-1,3-dicarboxylic acid (PubChem CID 68637111) has the molecular formula C6H10N2O4 and a molecular weight of 174.16 g/mol. Its IUPAC name is (3S)-piperazine-1,3-dicarboxylic acid.
| Compound Name | (3S)-piperazine-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 68637111 |
| Molecular Formula | C6H10N2O4 |
| Molecular Weight | 174.16 g/mol |
| Exact Mass | 174.06 |
| IUPAC Name | (3S)-piperazine-1,3-dicarboxylic acid |
| SMILES | O=C(O)[C@@H]1CN(C(=O)O)CCN1 |
| InChI | InChI=1S/C6H10N2O4/c9-5(10)4-3-8(6(11)12)2-1-7-4/h4,7H,1-3H2,(H,9,10)(H,11,12)/t4-/m0/s1 |
| InChIKey | SUDYQKKBKMGXKU-BYPYZUCNSA-N |
| XLogP | -0.98 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.16 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |