C18H26N2O3 — CID 170562977
benzyl 3-(pent-4-enoxymethyl)piperazine-1-carboxylate (PubChem CID 170562977) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is benzyl 3-(pent-4-enoxymethyl)piperazine-1-carboxylate.
| Compound Name | benzyl 3-(pent-4-enoxymethyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 170562977 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | benzyl 3-(pent-4-enoxymethyl)piperazine-1-carboxylate |
| SMILES | C=CCCCOCC1CN(C(=O)OCc2ccccc2)CCN1 |
| InChI | InChI=1S/C18H26N2O3/c1-2-3-7-12-22-15-17-13-20(11-10-19-17)18(21)23-14-16-8-5-4-6-9-16/h2,4-6,8-9,17,19H,1,3,7,10-15H2 |
| InChIKey | YJYVGSJAQUGNPR-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|