C21H24N4O2 — CID 91596290
benzyl (3R)-3-[2-(2-cyanoanilino)ethyl]piperazine-1-carboxylate (PubChem CID 91596290) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is benzyl (3R)-3-[2-(2-cyanoanilino)ethyl]piperazine-1-carboxylate.
| Compound Name | benzyl (3R)-3-[2-(2-cyanoanilino)ethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 91596290 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | benzyl (3R)-3-[2-(2-cyanoanilino)ethyl]piperazine-1-carboxylate |
| SMILES | N#Cc1ccccc1NCC[C@@H]1CN(C(=O)OCc2ccccc2)CCN1 |
| InChI | InChI=1S/C21H24N4O2/c22-14-18-8-4-5-9-20(18)24-11-10-19-15-25(13-12-23-19)21(26)27-16-17-6-2-1-3-7-17/h1-9,19,23-24H,10-13,15-16H2/t19-/m1/s1 |
| InChIKey | SJECTNDXVRKWOB-LJQANCHMSA-N |
| XLogP | 2.97 |
| TPSA | 77.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |