C21H24N4O2S — CID 91207665
benzyl (3R)-3-[2-(1,3-benzothiazol-2-ylamino)ethyl]piperazine-1-carboxylate (PubChem CID 91207665) has the molecular formula C21H24N4O2S and a molecular weight of 396.52 g/mol. Its IUPAC name is benzyl (3R)-3-[2-(1,3-benzothiazol-2-ylamino)ethyl]piperazine-1-carboxylate.
| Compound Name | benzyl (3R)-3-[2-(1,3-benzothiazol-2-ylamino)ethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 91207665 |
| Molecular Formula | C21H24N4O2S |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | benzyl (3R)-3-[2-(1,3-benzothiazol-2-ylamino)ethyl]piperazine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCN[C@H](CCNc2nc3ccccc3s2)C1 |
| InChI | InChI=1S/C21H24N4O2S/c26-21(27-15-16-6-2-1-3-7-16)25-13-12-22-17(14-25)10-11-23-20-24-18-8-4-5-9-19(18)28-20/h1-9,17,22H,10-15H2,(H,23,24)/t17-/m1/s1 |
| InChIKey | AAAGBCKVHPYPNH-QGZVFWFLSA-N |
| XLogP | 3.71 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |