C18H25N5O3 — CID 90878457
benzyl (3R)-3-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]piperazine-1-carboxylate (PubChem CID 90878457) has the molecular formula C18H25N5O3 and a molecular weight of 359.43 g/mol. Its IUPAC name is benzyl (3R)-3-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]piperazine-1-carboxylate.
| Compound Name | benzyl (3R)-3-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 90878457 |
| Molecular Formula | C18H25N5O3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | benzyl (3R)-3-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]piperazine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCN[C@H](CCn2cc(CCO)nn2)C1 |
| InChI | InChI=1S/C18H25N5O3/c24-11-7-17-13-23(21-20-17)9-6-16-12-22(10-8-19-16)18(25)26-14-15-4-2-1-3-5-15/h1-5,13,16,19,24H,6-12,14H2/t16-/m1/s1 |
| InChIKey | HURFHPXKMMCWOO-MRXNPFEDSA-N |
| XLogP | 0.81 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |