C21H28N4O4 — CID 91470476
benzyl (3R)-3-[2-(5-ethoxycarbonyl-3-methylpyrazol-1-yl)ethyl]piperazine-1-carboxylate (PubChem CID 91470476) has the molecular formula C21H28N4O4 and a molecular weight of 400.48 g/mol. Its IUPAC name is benzyl (3R)-3-[2-(5-ethoxycarbonyl-3-methylpyrazol-1-yl)ethyl]piperazine-1-carboxylate.
| Compound Name | benzyl (3R)-3-[2-(5-ethoxycarbonyl-3-methylpyrazol-1-yl)ethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 91470476 |
| Molecular Formula | C21H28N4O4 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | benzyl (3R)-3-[2-(5-ethoxycarbonyl-3-methylpyrazol-1-yl)ethyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)c1cc(C)nn1CC[C@@H]1CN(C(=O)OCc2ccccc2)CCN1 |
| InChI | InChI=1S/C21H28N4O4/c1-3-28-20(26)19-13-16(2)23-25(19)11-9-18-14-24(12-10-22-18)21(27)29-15-17-7-5-4-6-8-17/h4-8,13,18,22H,3,9-12,14-15H2,1-2H3/t18-/m1/s1 |
| InChIKey | DIEQSRBTDYWPRF-GOSISDBHSA-N |
| XLogP | 2.37 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |