C22H25N3O4 — CID 91275032
benzyl (3R)-3-[2-[(1-oxo-3H-2-benzofuran-5-yl)amino]ethyl]piperazine-1-carboxylate (PubChem CID 91275032) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is benzyl (3R)-3-[2-[(1-oxo-3H-2-benzofuran-5-yl)amino]ethyl]piperazine-1-carboxylate.
| Compound Name | benzyl (3R)-3-[2-[(1-oxo-3H-2-benzofuran-5-yl)amino]ethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 91275032 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | benzyl (3R)-3-[2-[(1-oxo-3H-2-benzofuran-5-yl)amino]ethyl]piperazine-1-carboxylate |
| SMILES | O=C1OCc2cc(NCC[C@@H]3CN(C(=O)OCc4ccccc4)CCN3)ccc21 |
| InChI | InChI=1S/C22H25N3O4/c26-21-20-7-6-18(12-17(20)15-28-21)23-9-8-19-13-25(11-10-24-19)22(27)29-14-16-4-2-1-3-5-16/h1-7,12,19,23-24H,8-11,13-15H2/t19-/m1/s1 |
| InChIKey | TXJAAKUDNHSJME-LJQANCHMSA-N |
| XLogP | 2.77 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |