C19H36BNO4 — CID 174045918
methyl 2-[1-[(2R)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentan-2-yl]piperidin-4-yl]acetate (PubChem CID 174045918) has the molecular formula C19H36BNO4 and a molecular weight of 353.31 g/mol. Its IUPAC name is methyl 2-[1-[(2R)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentan-2-yl]piperidin-4-yl]acetate.
| Compound Name | methyl 2-[1-[(2R)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentan-2-yl]piperidin-4-yl]acetate |
|---|---|
| PubChem CID | 174045918 |
| Molecular Formula | C19H36BNO4 |
| Molecular Weight | 353.31 g/mol |
| Exact Mass | 353.27 |
| IUPAC Name | methyl 2-[1-[(2R)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentan-2-yl]piperidin-4-yl]acetate |
| SMILES | CCC(B1OC(C)(C)C(C)(C)O1)[C@@H](C)N1CCC(CC(=O)OC)CC1 |
| InChI | InChI=1S/C19H36BNO4/c1-8-16(20-24-18(3,4)19(5,6)25-20)14(2)21-11-9-15(10-12-21)13-17(22)23-7/h14-16H,8-13H2,1-7H3/t14-,16?/m1/s1 |
| InChIKey | SVDIJDSCPRKEBM-IURRXHLWSA-N |
| XLogP | 3.52 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.31 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|