C27H19BFN7O — CID 174046326
CID 174046326 (PubChem CID 174046326) has the molecular formula C27H19BFN7O and a molecular weight of 487.31 g/mol.
| Compound Name | CID 174046326 |
|---|---|
| PubChem CID | 174046326 |
| Molecular Formula | C27H19BFN7O |
| Molecular Weight | 487.31 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | — |
| SMILES | [B]C#Cc1cc2c(cn1)-c1c(-c3ccc(Oc4nccc(C)n4)c(F)c3)c3c(N)ncnc3n1CCC2 |
| InChI | InChI=1S/C27H19BFN7O/c1-15-7-9-31-27(35-15)37-21-5-4-17(12-20(21)29)22-23-25(30)33-14-34-26(23)36-10-2-3-16-11-18(6-8-28)32-13-19(16)24(22)36/h4-5,7,9,11-14H,2-3,10H2,1H3,(H2,30,33,34) |
| InChIKey | SSKVAKPNOQEZGG-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 104.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.31 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|