C27H32BNO — CID 174046615
3-phenyl-2-[2,4,6-tri(propan-2-yl)phenyl]-1,3,2-benzoxazaborole (PubChem CID 174046615) has the molecular formula C27H32BNO and a molecular weight of 397.37 g/mol. Its IUPAC name is 3-phenyl-2-[2,4,6-tri(propan-2-yl)phenyl]-1,3,2-benzoxazaborole.
| Compound Name | 3-phenyl-2-[2,4,6-tri(propan-2-yl)phenyl]-1,3,2-benzoxazaborole |
|---|---|
| PubChem CID | 174046615 |
| Molecular Formula | C27H32BNO |
| Molecular Weight | 397.37 g/mol |
| Exact Mass | 397.26 |
| IUPAC Name | 3-phenyl-2-[2,4,6-tri(propan-2-yl)phenyl]-1,3,2-benzoxazaborole |
| SMILES | CC(C)c1cc(C(C)C)c(B2Oc3ccccc3N2c2ccccc2)c(C(C)C)c1 |
| InChI | InChI=1S/C27H32BNO/c1-18(2)21-16-23(19(3)4)27(24(17-21)20(5)6)28-29(22-12-8-7-9-13-22)25-14-10-11-15-26(25)30-28/h7-20H,1-6H3 |
| InChIKey | CGZBANONLYVJFA-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.37 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|