C11H18F3N3 — CID 174047164
1,1,1-trifluoro-3-(methyliminomethyl)-4-piperidin-4-ylbut-2-en-2-amine (PubChem CID 174047164) has the molecular formula C11H18F3N3 and a molecular weight of 249.28 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-(methyliminomethyl)-4-piperidin-4-ylbut-2-en-2-amine.
| Compound Name | 1,1,1-trifluoro-3-(methyliminomethyl)-4-piperidin-4-ylbut-2-en-2-amine |
|---|---|
| PubChem CID | 174047164 |
| Molecular Formula | C11H18F3N3 |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 1,1,1-trifluoro-3-(methyliminomethyl)-4-piperidin-4-ylbut-2-en-2-amine |
| SMILES | C/N=C/C(CC1CCNCC1)=C(N)C(F)(F)F |
| InChI | InChI=1S/C11H18F3N3/c1-16-7-9(10(15)11(12,13)14)6-8-2-4-17-5-3-8/h7-8,17H,2-6,15H2,1H3/b10-9?,16-7+ |
| InChIKey | BEVWOAPEBJLHSM-GLADCSQHSA-N |
| XLogP | 1.85 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|