C12H20F2N2 — CID 178160345
3-(4,4-difluoropiperidin-3-yl)-4-methylhex-3-en-2-imine (PubChem CID 178160345) has the molecular formula C12H20F2N2 and a molecular weight of 230.30 g/mol. Its IUPAC name is 3-(4,4-difluoropiperidin-3-yl)-4-methylhex-3-en-2-imine.
| Compound Name | 3-(4,4-difluoropiperidin-3-yl)-4-methylhex-3-en-2-imine |
|---|---|
| PubChem CID | 178160345 |
| Molecular Formula | C12H20F2N2 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | 3-(4,4-difluoropiperidin-3-yl)-4-methylhex-3-en-2-imine |
| SMILES | [H]/N=C(\C)C(=C(C)CC)C1CNCCC1(F)F |
| InChI | InChI=1S/C12H20F2N2/c1-4-8(2)11(9(3)15)10-7-16-6-5-12(10,13)14/h10,15-16H,4-7H2,1-3H3/b11-8?,15-9+ |
| InChIKey | SMOQNIGVCVRCLX-JWCIJZKPSA-N |
| XLogP | 3.00 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|