C24H37BN3O7 — CID 174047214
CID 174047214 (PubChem CID 174047214) has the molecular formula C24H37BN3O7 and a molecular weight of 490.39 g/mol.
| Compound Name | CID 174047214 |
|---|---|
| PubChem CID | 174047214 |
| Molecular Formula | C24H37BN3O7 |
| Molecular Weight | 490.39 g/mol |
| Exact Mass | 490.27 |
| IUPAC Name | — |
| SMILES | [B]=C1C=CC(=O)N1CCC(=O)N1CCOCCN(C(=O)CCC(=O)OC(C)(C)CC)CCOCC1 |
| InChI | InChI=1S/C24H37BN3O7/c1-4-24(2,3)35-23(32)8-7-20(29)26-11-15-33-17-13-27(14-18-34-16-12-26)21(30)9-10-28-19(25)5-6-22(28)31/h5-6H,4,7-18H2,1-3H3 |
| InChIKey | QYYWAKMYBGEHJT-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 105.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.39 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|