C15H17ClN4O2S — CID 17405064
N-carbamoyl-2-[1-(4-chlorophenyl)imidazol-2-yl]sulfanyl-3-methylbutanamide (PubChem CID 17405064) has the molecular formula C15H17ClN4O2S and a molecular weight of 352.85 g/mol. Its IUPAC name is N-carbamoyl-2-[1-(4-chlorophenyl)imidazol-2-yl]sulfanyl-3-methylbutanamide.
| Compound Name | N-carbamoyl-2-[1-(4-chlorophenyl)imidazol-2-yl]sulfanyl-3-methylbutanamide |
|---|---|
| PubChem CID | 17405064 |
| Molecular Formula | C15H17ClN4O2S |
| Molecular Weight | 352.85 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | N-carbamoyl-2-[1-(4-chlorophenyl)imidazol-2-yl]sulfanyl-3-methylbutanamide |
| SMILES | CC(C)C(Sc1nccn1-c1ccc(Cl)cc1)C(=O)NC(N)=O |
| InChI | InChI=1S/C15H17ClN4O2S/c1-9(2)12(13(21)19-14(17)22)23-15-18-7-8-20(15)11-5-3-10(16)4-6-11/h3-9,12H,1-2H3,(H3,17,19,21,22) |
| InChIKey | FJRVKTAEFLQQHJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.85 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |