C13H17ClN2O2S — CID 8580236
(2R)-N-carbamoyl-2-[(4-chlorophenyl)methylsulfanyl]-3-methylbutanamide (PubChem CID 8580236) has the molecular formula C13H17ClN2O2S and a molecular weight of 300.81 g/mol. Its IUPAC name is (2R)-N-carbamoyl-2-[(4-chlorophenyl)methylsulfanyl]-3-methylbutanamide.
| Compound Name | (2R)-N-carbamoyl-2-[(4-chlorophenyl)methylsulfanyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 8580236 |
| Molecular Formula | C13H17ClN2O2S |
| Molecular Weight | 300.81 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | (2R)-N-carbamoyl-2-[(4-chlorophenyl)methylsulfanyl]-3-methylbutanamide |
| SMILES | CC(C)[C@@H](SCc1ccc(Cl)cc1)C(=O)NC(N)=O |
| InChI | InChI=1S/C13H17ClN2O2S/c1-8(2)11(12(17)16-13(15)18)19-7-9-3-5-10(14)6-4-9/h3-6,8,11H,7H2,1-2H3,(H3,15,16,17,18)/t11-/m1/s1 |
| InChIKey | LAXNMVHIHBXXSL-LLVKDONJSA-N |
| XLogP | 2.79 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.81 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |