About 1,1-dimethoxyethoxyaluminum(2+);hydride
1,1-dimethoxyethoxyaluminum(2+);hydride (PubChem CID 174051536) has the molecular formula C4H11AlO3
and a molecular weight of 134.11 g/mol. Its IUPAC name is 1,1-dimethoxyethoxyaluminum(2+);hydride.
Molecular Properties
| Compound Name | 1,1-dimethoxyethoxyaluminum(2+);hydride |
| PubChem CID | 174051536 |
| Molecular Formula | C4H11AlO3 |
| Molecular Weight | 134.11 g/mol |
| Exact Mass | 134.05 |
| IUPAC Name | 1,1-dimethoxyethoxyaluminum(2+);hydride |
| SMILES | COC(C)(OC)O[Al+2].[H-].[H-] |
| InChI | InChI=1S/C4H9O3.Al.2H/c1-4(5,6-2)7-3;;;/h1-3H3;;;/q-1;+3;2*-1 |
| InChIKey | UTZHKZXSSLUSIT-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.11 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dimethoxyethoxyaluminum(2+);hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dimethoxyethoxyaluminum(2+);hydride?
The IUPAC name of 1,1-dimethoxyethoxyaluminum(2+);hydride (CID 174051536) is 1,1-dimethoxyethoxyaluminum(2+);hydride.
What is the SMILES notation for 1,1-dimethoxyethoxyaluminum(2+);hydride?
The canonical SMILES for 1,1-dimethoxyethoxyaluminum(2+);hydride is COC(C)(OC)O[Al+2].[H-].[H-].
What is the InChIKey of 1,1-dimethoxyethoxyaluminum(2+);hydride?
The InChIKey is UTZHKZXSSLUSIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9O3.Al.2H/c1-4(5,6-2)7-3;;;/h1-3H3;;;/q-1;+3;2*-1.
What are the key properties of 1,1-dimethoxyethoxyaluminum(2+);hydride?
1,1-dimethoxyethoxyaluminum(2+);hydride has a molecular weight of 134.11 g/mol, XLogP of 0.28, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dimethoxyethoxyaluminum(2+);hydride is sourced from PubChem (CID 174051536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).