C10H22O7 — CID 87697718
1-(1,1-dimethoxyethoxymethoxymethoxy)-1,1-dimethoxyethane (PubChem CID 87697718) has the molecular formula C10H22O7 and a molecular weight of 254.28 g/mol. Its IUPAC name is 1-(1,1-dimethoxyethoxymethoxymethoxy)-1,1-dimethoxyethane.
| Compound Name | 1-(1,1-dimethoxyethoxymethoxymethoxy)-1,1-dimethoxyethane |
|---|---|
| PubChem CID | 87697718 |
| Molecular Formula | C10H22O7 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 1-(1,1-dimethoxyethoxymethoxymethoxy)-1,1-dimethoxyethane |
| SMILES | COC(C)(OC)OCOCOC(C)(OC)OC |
| InChI | InChI=1S/C10H22O7/c1-9(11-3,12-4)16-7-15-8-17-10(2,13-5)14-6/h7-8H2,1-6H3 |
| InChIKey | VAQBKVQCICKLHQ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|