About 2-ethenyl-1-trimethoxysilylpent-4-ene-1,1,2-triamine
2-ethenyl-1-trimethoxysilylpent-4-ene-1,1,2-triamine (PubChem CID 174051682) has the molecular formula C10H23N3O3Si
and a molecular weight of 261.40 g/mol. Its IUPAC name is 2-ethenyl-1-trimethoxysilylpent-4-ene-1,1,2-triamine.
Molecular Properties
| Compound Name | 2-ethenyl-1-trimethoxysilylpent-4-ene-1,1,2-triamine |
| PubChem CID | 174051682 |
| Molecular Formula | C10H23N3O3Si |
| Molecular Weight | 261.40 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 2-ethenyl-1-trimethoxysilylpent-4-ene-1,1,2-triamine |
| SMILES | C=CCC(N)(C=C)C(N)(N)[Si](OC)(OC)OC |
| InChI | InChI=1S/C10H23N3O3Si/c1-6-8-9(11,7-2)10(12,13)17(14-3,15-4)16-5/h6-7H,1-2,8,11-13H2,3-5H3 |
| InChIKey | GBDLWSVDRQZYKM-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 105.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.40 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-ethenyl-1-trimethoxysilylpent-4-ene-1,1,2-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenyl-1-trimethoxysilylpent-4-ene-1,1,2-triamine?
The IUPAC name of 2-ethenyl-1-trimethoxysilylpent-4-ene-1,1,2-triamine (CID 174051682) is 2-ethenyl-1-trimethoxysilylpent-4-ene-1,1,2-triamine.
What is the SMILES notation for 2-ethenyl-1-trimethoxysilylpent-4-ene-1,1,2-triamine?
The canonical SMILES for 2-ethenyl-1-trimethoxysilylpent-4-ene-1,1,2-triamine is C=CCC(N)(C=C)C(N)(N)[Si](OC)(OC)OC.
What is the InChIKey of 2-ethenyl-1-trimethoxysilylpent-4-ene-1,1,2-triamine?
The InChIKey is GBDLWSVDRQZYKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23N3O3Si/c1-6-8-9(11,7-2)10(12,13)17(14-3,15-4)16-5/h6-7H,1-2,8,11-13H2,3-5H3.
What are the key properties of 2-ethenyl-1-trimethoxysilylpent-4-ene-1,1,2-triamine?
2-ethenyl-1-trimethoxysilylpent-4-ene-1,1,2-triamine has a molecular weight of 261.40 g/mol, XLogP of -0.52, 8 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenyl-1-trimethoxysilylpent-4-ene-1,1,2-triamine is sourced from PubChem (CID 174051682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).