C10H23N3O3Si — CID 174051682
2-ethenyl-1-trimethoxysilylpent-4-ene-1,1,2-triamine (PubChem CID 174051682) has the molecular formula C10H23N3O3Si and a molecular weight of 261.40 g/mol. Its IUPAC name is 2-ethenyl-1-trimethoxysilylpent-4-ene-1,1,2-triamine.
| Compound Name | 2-ethenyl-1-trimethoxysilylpent-4-ene-1,1,2-triamine |
|---|---|
| PubChem CID | 174051682 |
| Molecular Formula | C10H23N3O3Si |
| Molecular Weight | 261.40 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 2-ethenyl-1-trimethoxysilylpent-4-ene-1,1,2-triamine |
| SMILES | C=CCC(N)(C=C)C(N)(N)[Si](OC)(OC)OC |
| InChI | InChI=1S/C10H23N3O3Si/c1-6-8-9(11,7-2)10(12,13)17(14-3,15-4)16-5/h6-7H,1-2,8,11-13H2,3-5H3 |
| InChIKey | GBDLWSVDRQZYKM-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 105.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.40 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|