C11H20O3Si — CID 175420918
3-ethenylhexa-1,5-dien-3-yl(trimethoxy)silane (PubChem CID 175420918) has the molecular formula C11H20O3Si and a molecular weight of 228.36 g/mol. Its IUPAC name is 3-ethenylhexa-1,5-dien-3-yl(trimethoxy)silane.
| Compound Name | 3-ethenylhexa-1,5-dien-3-yl(trimethoxy)silane |
|---|---|
| PubChem CID | 175420918 |
| Molecular Formula | C11H20O3Si |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | 3-ethenylhexa-1,5-dien-3-yl(trimethoxy)silane |
| SMILES | C=CCC(C=C)(C=C)[Si](OC)(OC)OC |
| InChI | InChI=1S/C11H20O3Si/c1-7-10-11(8-2,9-3)15(12-4,13-5)14-6/h7-9H,1-3,10H2,4-6H3 |
| InChIKey | IKDQLAOGDWUOIL-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|