C21H32BFN2O6 — CID 174051830
[1-[[4-(4-fluorophenyl)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]-3-methoxy-1-oxopropan-2-yl]carbamic acid (PubChem CID 174051830) has the molecular formula C21H32BFN2O6 and a molecular weight of 438.31 g/mol. Its IUPAC name is [1-[[4-(4-fluorophenyl)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]-3-methoxy-1-oxopropan-2-yl]carbamic acid.
| Compound Name | [1-[[4-(4-fluorophenyl)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]-3-methoxy-1-oxopropan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 174051830 |
| Molecular Formula | C21H32BFN2O6 |
| Molecular Weight | 438.31 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | [1-[[4-(4-fluorophenyl)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]-3-methoxy-1-oxopropan-2-yl]carbamic acid |
| SMILES | COCC(NC(=O)O)C(=O)NC(CCCc1ccc(F)cc1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C21H32BFN2O6/c1-20(2)21(3,4)31-22(30-20)17(8-6-7-14-9-11-15(23)12-10-14)25-18(26)16(13-29-5)24-19(27)28/h9-12,16-17,24H,6-8,13H2,1-5H3,(H,25,26)(H,27,28) |
| InChIKey | JSDBCGKXCODWEB-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.31 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|