C20H50O7Si6 — CID 174052205
[dimethyl-[1-tris(trimethylsilyloxy)silyloxyethyl]silyl] 2-methyl-4-silylhex-2-eneperoxoate (PubChem CID 174052205) has the molecular formula C20H50O7Si6 and a molecular weight of 571.13 g/mol. Its IUPAC name is [dimethyl-[1-tris(trimethylsilyloxy)silyloxyethyl]silyl] 2-methyl-4-silylhex-2-eneperoxoate.
| Compound Name | [dimethyl-[1-tris(trimethylsilyloxy)silyloxyethyl]silyl] 2-methyl-4-silylhex-2-eneperoxoate |
|---|---|
| PubChem CID | 174052205 |
| Molecular Formula | C20H50O7Si6 |
| Molecular Weight | 571.13 g/mol |
| Exact Mass | 570.22 |
| IUPAC Name | [dimethyl-[1-tris(trimethylsilyloxy)silyloxyethyl]silyl] 2-methyl-4-silylhex-2-eneperoxoate |
| SMILES | CCC([SiH3])C=C(C)C(=O)OO[Si](C)(C)C(C)O[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C20H50O7Si6/c1-15-19(28)16-17(2)20(21)22-24-32(13,14)18(3)23-33(25-29(4,5)6,26-30(7,8)9)27-31(10,11)12/h16,18-19H,15H2,1-14,28H3 |
| InChIKey | UZWAMDMDXNZBEN-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.13 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|