C9H25NOSi2 — CID 174052884
N,2-dimethylpropan-2-amine;3-methyloxadisilinane (PubChem CID 174052884) has the molecular formula C9H25NOSi2 and a molecular weight of 219.48 g/mol. Its IUPAC name is N,2-dimethylpropan-2-amine;3-methyloxadisilinane.
| Compound Name | N,2-dimethylpropan-2-amine;3-methyloxadisilinane |
|---|---|
| PubChem CID | 174052884 |
| Molecular Formula | C9H25NOSi2 |
| Molecular Weight | 219.48 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | N,2-dimethylpropan-2-amine;3-methyloxadisilinane |
| SMILES | CNC(C)(C)C.C[SiH]1CCCO[SiH2]1 |
| InChI | InChI=1S/C5H13N.C4H12OSi2/c1-5(2,3)6-4;1-7-4-2-3-5-6-7/h6H,1-4H3;7H,2-4,6H2,1H3 |
| InChIKey | BDPXFBUIRLBVAB-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.48 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|