C22H22F4N2O4 — CID 118643749
N'-tert-butyl-5-ethyl-N-(2,3,4,5-tetrafluorobenzoyl)-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide (PubChem CID 118643749) has the molecular formula C22H22F4N2O4 and a molecular weight of 454.42 g/mol. Its IUPAC name is N'-tert-butyl-5-ethyl-N-(2,3,4,5-tetrafluorobenzoyl)-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide.
| Compound Name | N'-tert-butyl-5-ethyl-N-(2,3,4,5-tetrafluorobenzoyl)-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide |
|---|---|
| PubChem CID | 118643749 |
| Molecular Formula | C22H22F4N2O4 |
| Molecular Weight | 454.42 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | N'-tert-butyl-5-ethyl-N-(2,3,4,5-tetrafluorobenzoyl)-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide |
| SMILES | CCc1c(C(=O)N(NC(C)(C)C)C(=O)c2cc(F)c(F)c(F)c2F)ccc2c1OCCO2 |
| InChI | InChI=1S/C22H22F4N2O4/c1-5-11-12(6-7-15-19(11)32-9-8-31-15)20(29)28(27-22(2,3)4)21(30)13-10-14(23)17(25)18(26)16(13)24/h6-7,10,27H,5,8-9H2,1-4H3 |
| InChIKey | UEMYSRLJYHSLQF-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.42 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|