C23H33FN2O3Si — CID 174053139
tert-butyl-[2-[[7-[(4-fluorophenyl)methyl]-2-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-6-yl]oxy]ethoxy]-dimethylsilane (PubChem CID 174053139) has the molecular formula C23H33FN2O3Si and a molecular weight of 432.61 g/mol. Its IUPAC name is tert-butyl-[2-[[7-[(4-fluorophenyl)methyl]-2-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-6-yl]oxy]ethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2-[[7-[(4-fluorophenyl)methyl]-2-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-6-yl]oxy]ethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 174053139 |
| Molecular Formula | C23H33FN2O3Si |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | tert-butyl-[2-[[7-[(4-fluorophenyl)methyl]-2-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-6-yl]oxy]ethoxy]-dimethylsilane |
| SMILES | CC1COc2nc(OCCO[Si](C)(C)C(C)(C)C)c(Cc3ccc(F)cc3)cc2N1 |
| InChI | InChI=1S/C23H33FN2O3Si/c1-16-15-28-22-20(25-16)14-18(13-17-7-9-19(24)10-8-17)21(26-22)27-11-12-29-30(5,6)23(2,3)4/h7-10,14,16,25H,11-13,15H2,1-6H3 |
| InChIKey | NQLYZRPZSIHPJM-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|