C13H20BFNNaO3 — CID 174054519
sodium;boranuide;(2R,5R)-2-(4-fluorophenyl)-4-hydroxy-5-methylpiperidine-1-carboxylic acid (PubChem CID 174054519) has the molecular formula C13H20BFNNaO3 and a molecular weight of 291.11 g/mol. Its IUPAC name is sodium;boranuide;(2R,5R)-2-(4-fluorophenyl)-4-hydroxy-5-methylpiperidine-1-carboxylic acid.
| Compound Name | sodium;boranuide;(2R,5R)-2-(4-fluorophenyl)-4-hydroxy-5-methylpiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 174054519 |
| Molecular Formula | C13H20BFNNaO3 |
| Molecular Weight | 291.11 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | sodium;boranuide;(2R,5R)-2-(4-fluorophenyl)-4-hydroxy-5-methylpiperidine-1-carboxylic acid |
| SMILES | C[C@@H]1CN(C(=O)O)[C@@H](c2ccc(F)cc2)CC1O.[BH4-].[Na+] |
| InChI | InChI=1S/C13H16FNO3.BH4.Na/c1-8-7-15(13(17)18)11(6-12(8)16)9-2-4-10(14)5-3-9;;/h2-5,8,11-12,16H,6-7H2,1H3,(H,17,18);1H4;/q;-1;+1/t8-,11-,12?;;/m1../s1 |
| InChIKey | SNZNXAFHKNYNRY-VNCYAAJRSA-N |
| XLogP | -2.20 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.11 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|