C12H13FN2O3 — CID 173168868
(2R)-2-(4-fluorophenyl)-4-hydroxyiminopiperidine-1-carboxylic acid (PubChem CID 173168868) has the molecular formula C12H13FN2O3 and a molecular weight of 252.24 g/mol. Its IUPAC name is (2R)-2-(4-fluorophenyl)-4-hydroxyiminopiperidine-1-carboxylic acid.
| Compound Name | (2R)-2-(4-fluorophenyl)-4-hydroxyiminopiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 173168868 |
| Molecular Formula | C12H13FN2O3 |
| Molecular Weight | 252.24 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | (2R)-2-(4-fluorophenyl)-4-hydroxyiminopiperidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCC(=NO)C[C@@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C12H13FN2O3/c13-9-3-1-8(2-4-9)11-7-10(14-18)5-6-15(11)12(16)17/h1-4,11,18H,5-7H2,(H,16,17)/t11-/m1/s1 |
| InChIKey | NZLFCOLPJQFUHD-LLVKDONJSA-N |
| XLogP | 2.47 |
| TPSA | 73.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.24 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|