C12H12FNO3 — CID 118089137
(2S,3S)-3-(4-fluorophenyl)-2-formylpyrrolidine-1-carboxylic acid (PubChem CID 118089137) has the molecular formula C12H12FNO3 and a molecular weight of 237.23 g/mol. Its IUPAC name is (2S,3S)-3-(4-fluorophenyl)-2-formylpyrrolidine-1-carboxylic acid.
| Compound Name | (2S,3S)-3-(4-fluorophenyl)-2-formylpyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 118089137 |
| Molecular Formula | C12H12FNO3 |
| Molecular Weight | 237.23 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | (2S,3S)-3-(4-fluorophenyl)-2-formylpyrrolidine-1-carboxylic acid |
| SMILES | O=C[C@@H]1[C@H](c2ccc(F)cc2)CCN1C(=O)O |
| InChI | InChI=1S/C12H12FNO3/c13-9-3-1-8(2-4-9)10-5-6-14(12(16)17)11(10)7-15/h1-4,7,10-11H,5-6H2,(H,16,17)/t10-,11+/m0/s1 |
| InChIKey | HMEVKDBGRFGRJC-WDEREUQCSA-N |
| XLogP | 1.86 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.23 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|