C13H14FNO3 — CID 155434176
2-[(2S,3S)-3-(4-fluorophenyl)oxiran-2-yl]pyrrolidine-1-carboxylic acid (PubChem CID 155434176) has the molecular formula C13H14FNO3 and a molecular weight of 251.26 g/mol. Its IUPAC name is 2-[(2S,3S)-3-(4-fluorophenyl)oxiran-2-yl]pyrrolidine-1-carboxylic acid.
| Compound Name | 2-[(2S,3S)-3-(4-fluorophenyl)oxiran-2-yl]pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 155434176 |
| Molecular Formula | C13H14FNO3 |
| Molecular Weight | 251.26 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | 2-[(2S,3S)-3-(4-fluorophenyl)oxiran-2-yl]pyrrolidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCCC1[C@@H]1O[C@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C13H14FNO3/c14-9-5-3-8(4-6-9)11-12(18-11)10-2-1-7-15(10)13(16)17/h3-6,10-12H,1-2,7H2,(H,16,17)/t10?,11-,12-/m0/s1 |
| InChIKey | LAXMJVBWXHPOJA-RAMGSTBQSA-N |
| XLogP | 2.41 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.26 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|