C22H26FN3O5S2 — CID 174057190
3-[(3-butyl-2-methyl-7-methylsulfanyl-1,1-dioxo-5-phenyl-3,4-dihydropyrido[2,3-f][1,2,5]thiadiazepin-8-yl)oxy]-2-fluoroprop-2-enoic acid (PubChem CID 174057190) has the molecular formula C22H26FN3O5S2 and a molecular weight of 495.60 g/mol. Its IUPAC name is 3-[(3-butyl-2-methyl-7-methylsulfanyl-1,1-dioxo-5-phenyl-3,4-dihydropyrido[2,3-f][1,2,5]thiadiazepin-8-yl)oxy]-2-fluoroprop-2-enoic acid.
| Compound Name | 3-[(3-butyl-2-methyl-7-methylsulfanyl-1,1-dioxo-5-phenyl-3,4-dihydropyrido[2,3-f][1,2,5]thiadiazepin-8-yl)oxy]-2-fluoroprop-2-enoic acid |
|---|---|
| PubChem CID | 174057190 |
| Molecular Formula | C22H26FN3O5S2 |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | 3-[(3-butyl-2-methyl-7-methylsulfanyl-1,1-dioxo-5-phenyl-3,4-dihydropyrido[2,3-f][1,2,5]thiadiazepin-8-yl)oxy]-2-fluoroprop-2-enoic acid |
| SMILES | CCCCC1CN(c2ccccc2)c2nc(SC)c(OC=C(F)C(=O)O)cc2S(=O)(=O)N1C |
| InChI | InChI=1S/C22H26FN3O5S2/c1-4-5-9-16-13-26(15-10-7-6-8-11-15)20-19(33(29,30)25(16)2)12-18(21(24-20)32-3)31-14-17(23)22(27)28/h6-8,10-12,14,16H,4-5,9,13H2,1-3H3,(H,27,28) |
| InChIKey | FLAXKSFUKBSPDX-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 100.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|