C24H29FN2O5S — CID 169162437
ethyl (Z)-3-[(3-butyl-2-methyl-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl)oxy]-2-fluoroprop-2-enoate (PubChem CID 169162437) has the molecular formula C24H29FN2O5S and a molecular weight of 476.57 g/mol. Its IUPAC name is ethyl (Z)-3-[(3-butyl-2-methyl-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl)oxy]-2-fluoroprop-2-enoate.
| Compound Name | ethyl (Z)-3-[(3-butyl-2-methyl-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl)oxy]-2-fluoroprop-2-enoate |
|---|---|
| PubChem CID | 169162437 |
| Molecular Formula | C24H29FN2O5S |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | ethyl (Z)-3-[(3-butyl-2-methyl-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl)oxy]-2-fluoroprop-2-enoate |
| SMILES | CCCCC1CN(c2ccccc2)c2ccc(O/C=C(\F)C(=O)OCC)cc2S(=O)(=O)N1C |
| InChI | InChI=1S/C24H29FN2O5S/c1-4-6-10-19-16-27(18-11-8-7-9-12-18)22-14-13-20(15-23(22)33(29,30)26(19)3)32-17-21(25)24(28)31-5-2/h7-9,11-15,17,19H,4-6,10,16H2,1-3H3/b21-17- |
| InChIKey | DETBACVVRRHMIH-FXBPSFAMSA-N |
| XLogP | 4.77 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|