C25H31FN2O5S2 — CID 169162418
ethyl (Z)-2-fluoro-3-[[3-(4-hydroxybutyl)-2-methyl-7-methylsulfanyl-1-oxo-5-phenyl-3,4-dihydro-1λ4,2,5-benzothiadiazepin-8-yl]oxy]prop-2-enoate (PubChem CID 169162418) has the molecular formula C25H31FN2O5S2 and a molecular weight of 522.66 g/mol. Its IUPAC name is ethyl (Z)-2-fluoro-3-[[3-(4-hydroxybutyl)-2-methyl-7-methylsulfanyl-1-oxo-5-phenyl-3,4-dihydro-1λ4,2,5-benzothiadiazepin-8-yl]oxy]prop-2-enoate.
| Compound Name | ethyl (Z)-2-fluoro-3-[[3-(4-hydroxybutyl)-2-methyl-7-methylsulfanyl-1-oxo-5-phenyl-3,4-dihydro-1λ4,2,5-benzothiadiazepin-8-yl]oxy]prop-2-enoate |
|---|---|
| PubChem CID | 169162418 |
| Molecular Formula | C25H31FN2O5S2 |
| Molecular Weight | 522.66 g/mol |
| Exact Mass | 522.17 |
| IUPAC Name | ethyl (Z)-2-fluoro-3-[[3-(4-hydroxybutyl)-2-methyl-7-methylsulfanyl-1-oxo-5-phenyl-3,4-dihydro-1λ4,2,5-benzothiadiazepin-8-yl]oxy]prop-2-enoate |
| SMILES | CCOC(=O)/C(F)=C/Oc1cc2c(cc1SC)N(c1ccccc1)CC(CCCCO)N(C)S2=O |
| InChI | InChI=1S/C25H31FN2O5S2/c1-4-32-25(30)20(26)17-33-22-15-24-21(14-23(22)34-3)28(18-10-6-5-7-11-18)16-19(12-8-9-13-29)27(2)35(24)31/h5-7,10-11,14-15,17,19,29H,4,8-9,12-13,16H2,1-3H3/b20-17- |
| InChIKey | HXRZHRMDXFSLDH-JZJYNLBNSA-N |
| XLogP | 4.80 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.66 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|