C25H36F2N2O3S2 — CID 169162189
ethyl (Z)-3-[[3-butyl-5-(4-fluorocyclohexyl)-2-methyl-7-methylsulfanyl-3,4-dihydro-1,2,5-benzothiadiazepin-8-yl]oxy]-2-fluoroprop-2-enoate (PubChem CID 169162189) has the molecular formula C25H36F2N2O3S2 and a molecular weight of 514.70 g/mol. Its IUPAC name is ethyl (Z)-3-[[3-butyl-5-(4-fluorocyclohexyl)-2-methyl-7-methylsulfanyl-3,4-dihydro-1,2,5-benzothiadiazepin-8-yl]oxy]-2-fluoroprop-2-enoate.
| Compound Name | ethyl (Z)-3-[[3-butyl-5-(4-fluorocyclohexyl)-2-methyl-7-methylsulfanyl-3,4-dihydro-1,2,5-benzothiadiazepin-8-yl]oxy]-2-fluoroprop-2-enoate |
|---|---|
| PubChem CID | 169162189 |
| Molecular Formula | C25H36F2N2O3S2 |
| Molecular Weight | 514.70 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | ethyl (Z)-3-[[3-butyl-5-(4-fluorocyclohexyl)-2-methyl-7-methylsulfanyl-3,4-dihydro-1,2,5-benzothiadiazepin-8-yl]oxy]-2-fluoroprop-2-enoate |
| SMILES | CCCCC1CN(C2CCC(F)CC2)c2cc(SC)c(O/C=C(\F)C(=O)OCC)cc2SN1C |
| InChI | InChI=1S/C25H36F2N2O3S2/c1-5-7-8-19-15-29(18-11-9-17(26)10-12-18)21-13-24(33-4)22(14-23(21)34-28(19)3)32-16-20(27)25(30)31-6-2/h13-14,16-19H,5-12,15H2,1-4H3/b20-16- |
| InChIKey | ANKGHLFRSQAARK-SILNSSARSA-N |
| XLogP | 6.76 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.70 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|