C29H36F3NO4S2 — CID 146272018
ethyl (Z)-3-[[3,3-dibutyl-5-(3,4-difluorophenyl)-7-methylsulfanyl-1-oxo-2,4-dihydro-1λ4,5-benzothiazepin-8-yl]oxy]-2-fluoroprop-2-enoate (PubChem CID 146272018) has the molecular formula C29H36F3NO4S2 and a molecular weight of 583.74 g/mol. Its IUPAC name is ethyl (Z)-3-[[3,3-dibutyl-5-(3,4-difluorophenyl)-7-methylsulfanyl-1-oxo-2,4-dihydro-1λ4,5-benzothiazepin-8-yl]oxy]-2-fluoroprop-2-enoate.
| Compound Name | ethyl (Z)-3-[[3,3-dibutyl-5-(3,4-difluorophenyl)-7-methylsulfanyl-1-oxo-2,4-dihydro-1λ4,5-benzothiazepin-8-yl]oxy]-2-fluoroprop-2-enoate |
|---|---|
| PubChem CID | 146272018 |
| Molecular Formula | C29H36F3NO4S2 |
| Molecular Weight | 583.74 g/mol |
| Exact Mass | 583.20 |
| IUPAC Name | ethyl (Z)-3-[[3,3-dibutyl-5-(3,4-difluorophenyl)-7-methylsulfanyl-1-oxo-2,4-dihydro-1λ4,5-benzothiazepin-8-yl]oxy]-2-fluoroprop-2-enoate |
| SMILES | CCCCC1(CCCC)CN(c2ccc(F)c(F)c2)c2cc(SC)c(O/C=C(\F)C(=O)OCC)cc2S(=O)C1 |
| InChI | InChI=1S/C29H36F3NO4S2/c1-5-8-12-29(13-9-6-2)18-33(20-10-11-21(30)22(31)14-20)24-15-26(38-4)25(16-27(24)39(35)19-29)37-17-23(32)28(34)36-7-3/h10-11,14-17H,5-9,12-13,18-19H2,1-4H3/b23-17- |
| InChIKey | PNRNZFXMGOTGOH-QJOMJCCJSA-N |
| XLogP | 8.07 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.74 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|