C25H31F2NO3S2 — CID 163389076
butane;ethyl (Z)-2-fluoro-3-[[5-(4-fluorophenyl)-7-methylsulfanyl-3,4-dihydro-2H-1,5-benzothiazepin-8-yl]oxy]prop-2-enoate (PubChem CID 163389076) has the molecular formula C25H31F2NO3S2 and a molecular weight of 495.66 g/mol. Its IUPAC name is butane;ethyl (Z)-2-fluoro-3-[[5-(4-fluorophenyl)-7-methylsulfanyl-3,4-dihydro-2H-1,5-benzothiazepin-8-yl]oxy]prop-2-enoate.
| Compound Name | butane;ethyl (Z)-2-fluoro-3-[[5-(4-fluorophenyl)-7-methylsulfanyl-3,4-dihydro-2H-1,5-benzothiazepin-8-yl]oxy]prop-2-enoate |
|---|---|
| PubChem CID | 163389076 |
| Molecular Formula | C25H31F2NO3S2 |
| Molecular Weight | 495.66 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | butane;ethyl (Z)-2-fluoro-3-[[5-(4-fluorophenyl)-7-methylsulfanyl-3,4-dihydro-2H-1,5-benzothiazepin-8-yl]oxy]prop-2-enoate |
| SMILES | CCCC.CCOC(=O)/C(F)=C/Oc1cc2c(cc1SC)N(c1ccc(F)cc1)CCCS2 |
| InChI | InChI=1S/C21H21F2NO3S2.C4H10/c1-3-26-21(25)16(23)13-27-18-12-19-17(11-20(18)28-2)24(9-4-10-29-19)15-7-5-14(22)6-8-15;1-3-4-2/h5-8,11-13H,3-4,9-10H2,1-2H3;3-4H2,1-2H3/b16-13-; |
| InChIKey | AEFTUAGXVCPDAZ-UNVLYCKESA-N |
| XLogP | 7.74 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.66 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|